octyl isobutyrate


octyl isobutyrate
CAS RN:[109-15-9]
Formula:C12H24O2; 200.32 g/mol
InChiKey:PQCYCHFQWMNQRJ-UHFFFAOYSA-N
SMILES:CCCCCCCCOC(=O)C(C)C
Molecular structure of octyl isobutyrate
Density:0.856 g/mL
Molar volume:234.0 mL/mol
Boiling point:245 °C

Isomers

butyl octanoate
Molecular structure of butyl octanoate
2-butyloctanoic acid
Molecular structure of 2-butyloctanoic acid
decyl acetate
Molecular structure of decyl acetate
9,9-dimethyldecanoic acid
Molecular structure of 9,9-dimethyldecanoic acid
dodecanoic acid
Molecular structure of dodecanoic acid
ethyl decanoate
Molecular structure of ethyl decanoate
heptyl pentanoate
Molecular structure of heptyl pentanoate
hexyl hexanoate
Molecular structure of hexyl hexanoate
3-hydroxy-2,2,5,5-tetraethyltetrahydrofuran
Molecular structure of 3-hydroxy-2,2,5,5-tetraethyltetrahydrofuran
isobutyl octanoate
Molecular structure of isobutyl octanoate
methyl undecanoate
Molecular structure of methyl undecanoate
octyl butanoate
Molecular structure of octyl butanoate
octyl isobutyrate
Molecular structure of octyl isobutyrate
pentyl heptanoate
Molecular structure of pentyl heptanoate